Chemistry for Physiology

    Chemistry for Physiology
    Which of the following mechanisms results in acid being excreted from the body?
    As CO2 exhaled from the lungs, carbonic acid in the blood converts into carbon dioxide and water. So as carbon dioxide is exhaled, the amount of carbonic acid within the body decreases.
    Chemistry for Physiology
    Which of the following structures represents molecules belonging to the amide family?
    The “amide” functional group consists of a carbon, an oxygen and a nitrogen atom. The carbon atom is double bonded to an oxygen atom while also being single bonded to a nitrogen atom.
    Chemistry for Physiology
    Which statement describing the chemical reactivity of organic molecules is FALSE?
    Reactivity IS in fact influenced by the number and nature of the carbon rings. So the statement B is false.
    Chemistry for Physiology
    Which of the following statements relating to a patient with severe loss of potassium due to diuretic abuse is TRUE?
    A loss of potassium may be treated by administering potassium. Hypokalaemia refers to a blood concentration of <3 mmol/L, and such a level could affect the heart so an ECG IS warranted.
    Chemistry for Physiology
    What are the bonds that maintain the secondary and tertiary structure of proteins?
    Hydrogen bonds acting between N and H. Covalent bonds act between the atoms of an amino acid, while peptide bond (=covalent bond) is the term used for the bond between one amino acid to the adjacent one.
    Chemistry for Physiology
    The carbonic acid and bicarbonate buffer system is one if the buffers that help to maintain the blood’s pH within the healthy range by doing which of the following?
    A buffer has two components. One is capable of destroying acid, while the other is capable of destroying base.
    Chemistry for Physiology
    If the concentration of a solution is 5%, which of the following is true?
    5% = 5% = 5 per hundred = 5 g per 100 ml of solution.
    Chemistry for Physiology
    To which of the following class of biological compounds do all enzymes belong?
    All enzymes are proteins.
    Chemistry for Physiology
    Which of the following statements about atoms is FALSE?
    For the elements with smaller atoms, usually this is true. For heavier elements it is not.
    Chemistry for Physiology
    The formula for oleic acid (a fatty acid) may be written as: CH3(CH2)7CH=CH(CH2)7CO2H. How many atoms of each type of element are there in a molecule of oleic acid?
    The number of atoms written as a subscript immediately follows the symbol for the element; hence there are 2 atoms of oxygen (O). The number 7 outside the parentheses means that there are 7 lots of the atoms that are inside the parentheses. Hence, it is 14 + 14 H inside the parentheses, with a further 6 H outside them, which totals 34 H.